880362-05-0 Usage
Uses
As of the time of this writing, detailed information specific to the uses of 1-(3-METHYL-PYRIDIN-2-YL)-[1,4]DIAZEPANE remains unavailable or unexamined. However, given its chemical structure, it is likely that 1-(3-METHYL-PYRIDIN-2-YL)-[1,4]DIAZEPANE may have potential applications in various fields, such as pharmaceuticals, materials science, or chemical research. Further study and research are required to determine its specific uses, potential benefits, and any associated hazards or toxicity.
Check Digit Verification of cas no
The CAS Registry Mumber 880362-05-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,0,3,6 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 880362-05:
(8*8)+(7*8)+(6*0)+(5*3)+(4*6)+(3*2)+(2*0)+(1*5)=170
170 % 10 = 0
So 880362-05-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3/c1-10-4-2-6-13-11(10)14-8-3-5-12-7-9-14/h2,4,6,12H,3,5,7-9H2,1H3
