88046-02-0 Usage
Uses
Used in Pharmaceutical Industry:
2-Bromo-4-(1-piperidinomethyl)pyridine is used as a building block for the synthesis of various pharmaceuticals. Its unique structure and functional groups contribute to the development of new drugs, enhancing their therapeutic potential and efficacy.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Bromo-4-(1-piperidinomethyl)pyridine serves as a key intermediate in the synthesis of crop protection agents. Its reactivity and potential biological activity are harnessed to create effective solutions for agricultural applications.
Due to the reactivity and potential biological activity of 2-Bromo-4-(1-piperidinomethyl)pyridine, it is essential to handle and use 2-BROMO-4-(1-PIPERIDINOMETHYL)PYRIDINE with appropriate safety precautions in a controlled laboratory environment to ensure the safety of researchers and the integrity of the synthesis process.
Check Digit Verification of cas no
The CAS Registry Mumber 88046-02-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,0,4 and 6 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 88046-02:
(7*8)+(6*8)+(5*0)+(4*4)+(3*6)+(2*0)+(1*2)=140
140 % 10 = 0
So 88046-02-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BrN3/c11-10-7-9(1-2-13-10)8-14-5-3-12-4-6-14/h1-2,7,12H,3-6,8H2
