881189-75-9 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs and therapeutic agents. Its biologically active properties allow it to be a key component in creating effective treatments for a range of medical conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one is utilized as an intermediate in the production of agrochemicals, leveraging its reactivity and properties to enhance the effectiveness of agricultural products such as pesticides and herbicides.
Used in Research and Development:
6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one is employed in research and development applications, where its unique structure and properties are explored for potential uses in creating innovative pharmaceutical and agrochemical products. Its role in this context is crucial for advancing scientific knowledge and improving existing products.
Used in Material Science:
6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one has potential applications in the field of material science, where its properties may contribute to the development of new materials with specific characteristics, such as improved stability or reactivity.
Used as a Building Block for Organic Synthesis:
6-Chloro-5-fluoro-2,3-dihydro-1H-inden-1-one also serves as a building block for the synthesis of other organic compounds, providing a foundation for creating a diverse range of chemical products with various applications in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 881189-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,1,1,8 and 9 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 881189-75:
(8*8)+(7*8)+(6*1)+(5*1)+(4*8)+(3*9)+(2*7)+(1*5)=209
209 % 10 = 9
So 881189-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H6ClFO/c10-7-4-6-5(3-8(7)11)1-2-9(6)12/h3-4H,1-2H2
881189-75-9Relevant academic research and scientific papers
CYCLIC AMINE DERIVATIVE OR SALT THEREOF
-
Page/Page column 23; 44, (2010/11/27)
Provided are compounds which are an NMDA antagonist having a broad safety margin and are useful as a treating agent or a preventing agent for Alzheimer's disease, cerebrovascular dementia, Parkinson's disease, ischemic apoplexy, pain, etc. Concretely prov
