881891-82-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-3-fluoro-4-methylpyridine is used as an intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its unique structure allows for the creation of diverse chemical entities with potential medicinal properties.
Used in Agrochemical Industry:
In the agrochemical sector, 2-chloro-3-fluoro-4-methylpyridine serves as an intermediate for the synthesis of various agrochemicals, including pesticides and herbicides. Its incorporation into these compounds can enhance their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used in Organic Compounds Manufacturing:
2-Chloro-3-fluoro-4-methylpyridine is utilized in the manufacturing of other organic compounds, expanding its applications beyond the pharmaceutical and agrochemical industries. Its presence in these compounds can impart specific properties, such as reactivity or stability, depending on the desired outcome.
Used as a Building Block in Chemical Reactions:
As a building block in chemical reactions, 2-chloro-3-fluoro-4-methylpyridine plays a crucial role in the synthesis of complex organic molecules. Its reactivity and structural features make it a valuable component in the construction of intricate molecular architectures, facilitating advancements in various fields of chemistry.
Physical Properties and Safety:
2-Chloro-3-fluoro-4-methylpyridine is a colorless to pale yellow liquid with a pungent odor. Due to its potential hazards, it should be handled and stored with care to ensure safety during its use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 881891-82-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,1,8,9 and 1 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 881891-82:
(8*8)+(7*8)+(6*1)+(5*8)+(4*9)+(3*1)+(2*8)+(1*2)=223
223 % 10 = 3
So 881891-82-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClFN/c1-4-2-3-9-6(7)5(4)8/h2-3H,1H3
881891-82-3Relevant academic research and scientific papers
PYRIDINE DERIVATIVES AND THEIR USE AS MEDICAMENTS FOR TREATING DISEASES RELATED TO MCH RECEPTOR
-
Page/Page column 99, (2010/10/20)
The present invention encompasses novel substituted pyridine compounds of Formula (I), which act as MCH receptor antagonists. These compositions and pharmaceutical compositions thereof are useful in the prophylaxis or treatment of improving memory function, sleeping and arousal, anxiety, depression, mood disorders, seizure, obesity, diabetes, appetite and eating disorders, cardiovascular disease, hypertension, dyslipidemia, myocardial infarction, binge eating disorders including bulimia, anorexia, mental disorders including manic depression, schizophrenia, delirium, dementia, stress, cognitive disorders, attention deficit disorder, substance abuse disorders and dyskinesias including Parkinson's disease, epilepsy, and addiction.
