882167-77-3 Usage
Uses
Used in Organic Synthesis:
4-Chloro-N-methylpyridine-2-carboxamide Hydrochloride is used as a synthetic intermediate for the preparation of a wide range of organic compounds. Its reactivity and functional groups enable chemists to carry out various chemical transformations, such as nucleophilic substitutions, electrophilic aromatic substitutions, and amide bond formations, to construct complex organic molecules with potential applications in pharmaceuticals, agrochemicals, and materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Chloro-N-methylpyridine-2-carboxamide Hydrochloride is used as a key building block for the development of novel drug candidates. Its structural features can be incorporated into various drug molecules, potentially leading to the discovery of new therapeutic agents with improved pharmacological properties, such as enhanced potency, selectivity, and bioavailability.
Used in Agrochemical Industry:
4-Chloro-N-methylpyridine-2-carboxamide Hydrochloride also finds applications in the agrochemical industry, where it can be used as a starting material for the synthesis of new pesticides, herbicides, and insecticides. Its unique chemical properties can be exploited to design and develop innovative agrochemicals with improved efficacy, selectivity, and environmental compatibility.
Used in Materials Science:
In the field of materials science, 4-Chloro-N-methylpyridine-2-carboxamide Hydrochloride can be utilized as a precursor for the synthesis of advanced materials, such as conductive polymers, sensors, and catalysts. Its versatile chemical reactivity and functional groups can be employed to create novel materials with unique properties and applications in various industries, including electronics, energy, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 882167-77-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,2,1,6 and 7 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 882167-77:
(8*8)+(7*8)+(6*2)+(5*1)+(4*6)+(3*7)+(2*7)+(1*7)=203
203 % 10 = 3
So 882167-77-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClN2O.ClH/c1-9-7(11)6-4-5(8)2-3-10-6;/h2-4H,1H3,(H,9,11);1H
