883107-61-7 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
4-CHLORO-2-(1-PIPERIDIN-4-OL)-5-THIAZOLECARBOXALDEHYDE is used as a valuable building block for the synthesis of various medicinal compounds due to its unique structure and functional groups. Its presence of a chloro substituent and a piperidin-4-ol moiety gives it interesting chemical and pharmacological properties, making it a target for further investigation and potential therapeutic applications.
Used in Chemical Synthesis:
In the chemical synthesis industry, 4-CHLORO-2-(1-PIPERIDIN-4-OL)-5-THIAZOLECARBOXALDEHYDE is used as a key intermediate for the development of new chemical entities. Its unique structure allows for the creation of a wide range of compounds with diverse applications, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Medicinal Chemistry:
4-CHLORO-2-(1-PIPERIDIN-4-OL)-5-THIAZOLECARBOXALDEHYDE is used as a starting material in medicinal chemistry for the design and synthesis of novel therapeutic agents. Its potential biological activity and interesting chemical properties make it a promising candidate for the development of new drugs targeting various diseases and conditions.
Used in Drug Discovery:
In the field of drug discovery, 4-CHLORO-2-(1-PIPERIDIN-4-OL)-5-THIAZOLECARBOXALDEHYDE is used as a lead compound for the identification and optimization of new drug candidates. Its unique structure and functional groups provide a solid foundation for the development of innovative therapeutic agents with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 883107-61-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,3,1,0 and 7 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 883107-61:
(8*8)+(7*8)+(6*3)+(5*1)+(4*0)+(3*7)+(2*6)+(1*1)=177
177 % 10 = 7
So 883107-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11ClN2O2S/c10-8-7(5-13)15-9(11-8)12-3-1-6(14)2-4-12/h5-6,14H,1-4H2
