883547-94-2 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
3-[(4-METHYLPHENOXY)METHYL]PIPERIDINE is used as a chemical intermediate for the synthesis of potential drugs for the treatment of various medical conditions. Its specific pharmacological and biological properties have not been extensively studied or reported, but its structural features suggest that it may have potential therapeutic effects for certain diseases.
Further research is needed to fully understand the properties and potential applications of 3-[(4-METHYLPHENOXY)METHYL]PIPERIDINE, as its current applications are primarily limited to the synthesis of potential drugs in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 883547-94-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,3,5,4 and 7 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 883547-94:
(8*8)+(7*8)+(6*3)+(5*5)+(4*4)+(3*7)+(2*9)+(1*4)=222
222 % 10 = 2
So 883547-94-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H19NO/c1-11-4-6-13(7-5-11)15-10-12-3-2-8-14-9-12/h4-7,12,14H,2-3,8-10H2,1H3
