884058-04-2 Usage
Uses
Used in Pharmaceutical Industry:
5-(Chloromethyl)-3-propyl-1,2,4-oxadiazole is used as a key intermediate in the synthesis of various pharmaceuticals for its antimicrobial, anticancer, and anti-inflammatory properties. Its unique structure allows for the development of new drugs with improved efficacy and reduced side effects.
Used in Agrochemical Industry:
In the agrochemical industry, 5-(Chloromethyl)-3-propyl-1,2,4-oxadiazole is used as a building block for the creation of novel agrochemicals with enhanced pesticidal properties. Its incorporation into these compounds can lead to more effective and targeted pest control solutions.
Used in Fluorescent Probe Development:
5-(Chloromethyl)-3-propyl-1,2,4-oxadiazole is utilized as a fluorescent probe in scientific research due to its optical properties. Its ability to emit light upon excitation makes it a valuable tool for studying biological processes and detecting specific molecules within complex systems.
Used in Material Science Applications:
In the field of material science, 5-(Chloromethyl)-3-propyl-1,2,4-oxadiazole is explored for its potential use in the development of new materials with unique properties. Its incorporation into polymers and other materials can enhance their performance, making them suitable for various applications, such as sensors, coatings, and advanced materials for electronics and energy storage.
Check Digit Verification of cas no
The CAS Registry Mumber 884058-04-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,0,5 and 8 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 884058-04:
(8*8)+(7*8)+(6*4)+(5*0)+(4*5)+(3*8)+(2*0)+(1*4)=192
192 % 10 = 2
So 884058-04-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H9ClN2O/c1-2-3-5-8-6(4-7)10-9-5/h2-4H2,1H3
