884494-44-4 Usage
Uses
Used in Chemical Reactions and Organic Synthesis:
2-CHLORO-4-IODOPYRIDINE-3-METHANOL is used as a reactant in various chemical reactions and organic synthesis processes. Its unique structure allows it to participate in a range of reactions, contributing to the formation of new compounds with diverse properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-CHLORO-4-IODOPYRIDINE-3-METHANOL is used as a starting material or intermediate in the synthesis of pharmaceutical compounds. Its presence of different functional groups makes it a versatile building block for the development of new drugs with potential therapeutic effects.
Used in Research and Development:
2-CHLORO-4-IODOPYRIDINE-3-METHANOL is utilized in research and development for the exploration of its chemical properties and potential applications. Its unique structure and reactivity make it an important compound for studying the synthesis of new molecules and understanding the underlying chemical mechanisms.
Used in Industrial Applications:
2-CHLORO-4-IODOPYRIDINE-3-METHANOL is employed in various industrial applications, including the production of specialty chemicals, agrochemicals, and materials. Its versatility and reactivity contribute to the development of innovative products and processes in different sectors.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-44-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 884494-44:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*4)+(1*4)=224
224 % 10 = 4
So 884494-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClINO/c7-6-4(3-10)5(8)1-2-9-6/h1-2,10H,3H2
884494-44-4Relevant academic research and scientific papers
DIFLUOROMETHYLENE COMPOUND
-
Paragraph 0807-0809, (2015/06/16)
The present invention relates to a compound having an URAT1 inhibitory activity, and to an URAT1 inhibitor, a blood uric acid level-reducing agent and a pharmaceutical composition containing the compound. More specifically, the present invention relates to a compound represented by the formula (I): wherein R1 is -Q1-A1 or the like; R2 is a hydrogen atom, a halogen atom, a lower alkyl group or the like; W1, W2, W3 and W4 are each independently a nitrogen atom or a methine group optionally having substituents, or the like; X and Y are each a single bond, an oxygen atom or the like; Z is a hydroxyl group or COOR3 or the like.
