884494-50-2 Usage
Uses
Used in Pharmaceutical Industry:
2-CHLORO-5-FLUORO-4-IODO-3-PICOLINE is used as a building block for the synthesis of various pharmaceuticals. Its unique molecular structure and reactivity make it a valuable component in the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 2-CHLORO-5-FLUORO-4-IODO-3-PICOLINE serves as a key intermediate in the production of agrochemicals. Its halogenated nature allows for the creation of compounds with targeted pesticidal or herbicidal activities, contributing to more effective crop protection.
Used in Fine Chemicals Industry:
2-CHLORO-5-FLUORO-4-IODO-3-PICOLINE is utilized in the synthesis of fine chemicals, which are high-purity chemicals used in various applications such as fragrances, dyes, and specialty chemicals. Its unique properties enable the production of compounds with specific characteristics, catering to the demands of niche markets.
Used in Research and Development:
2-CHLORO-5-FLUORO-4-IODO-3-PICOLINE is employed in the research and development of new chemical compounds due to its distinctive molecular structure. Its reactivity as a halogenated picoline derivative allows scientists to explore novel chemical reactions and syntheses, potentially leading to the discovery of innovative materials and compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-50-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 884494-50:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*5)+(1*0)=222
222 % 10 = 2
So 884494-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClFIN/c1-3-5(9)4(8)2-10-6(3)7/h2H,1H3
