884494-52-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-2-fluoro-4-iodopyridine is used as a key intermediate in the synthesis of novel drug compounds. Its unique structure allows for the development of new pharmaceuticals with potential therapeutic applications, contributing to advancements in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-2-fluoro-4-iodopyridine serves as a crucial component in the creation of new pesticides and herbicides. Its incorporation into these products can enhance their effectiveness in controlling pests and weeds, thereby improving agricultural productivity.
Used in Materials Science:
3-Bromo-2-fluoro-4-iodopyridine also finds potential applications in materials science, where its unique properties can be harnessed to develop new materials with specific characteristics, such as improved stability or reactivity.
Used in Organic Synthesis:
As a versatile building block, 3-Bromo-2-fluoro-4-iodopyridine is utilized in organic synthesis for the preparation of a wide range of complex organic molecules. Its presence in these molecules can impart new functionalities and properties, expanding the scope of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 884494-52:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*5)+(1*2)=224
224 % 10 = 4
So 884494-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H2BrFIN/c6-4-3(8)1-2-9-5(4)7/h1-2H
