884494-89-7 Usage
Uses
Used in Pharmaceutical Industry:
5-Fluoro-2-methoxy-3-methylpyridine is used as a synthetic intermediate for the development of pharmaceuticals. Its unique structure allows it to be a key component in the creation of new drugs, potentially contributing to advancements in medicinal chemistry and drug discovery.
Used in Agrochemical Industry:
In the agrochemical sector, 5-Fluoro-2-methoxy-3-methylpyridine serves as an intermediate in the synthesis of agrochemicals. Its incorporation into these products can enhance their effectiveness in agricultural applications, such as pest control and crop protection.
Used in Organic Compound Production:
5-Fluoro-2-methoxy-3-methylpyridine is utilized in the production of organic compounds, where its specific functional groups can be manipulated to create a variety of chemical entities with different properties and applications.
Used as a Building Block in Chemical Reactions:
5-Fluoro-2-methoxy-3-methylpyridine also acts as a building block in various chemical reactions, enabling the formation of complex molecules and structures that can be applied across multiple industries.
Safety Considerations:
It is crucial to review and understand the safety data of 5-Fluoro-2-methoxy-3-methylpyridine before handling or use to ensure proper safety measures are in place and to minimize potential risks associated with its manipulation or synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 884494-89-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 4 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 884494-89:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*4)+(2*8)+(1*9)=237
237 % 10 = 7
So 884494-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8FNO/c1-5-3-6(8)4-9-7(5)10-2/h3-4H,1-2H3
