884495-01-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Bromo-5-fluoro-2(1H)-pyridinone is used as a building block for the synthesis of pharmaceutically active compounds. Its unique structure and properties make it a valuable component in the development of new drugs, contributing to the advancement of medicine.
Used in Organic Chemistry Research:
4-Bromo-5-fluoro-2(1H)-pyridinone is used as a reagent in organic chemistry research, facilitating the synthesis of more complex molecules. Its versatility in chemical reactions allows for the exploration of new pathways and the discovery of novel compounds with potential applications in various fields.
Used in Material Science:
4-Bromo-5-fluoro-2(1H)-pyridinone is used as a component in the development of new materials, such as polymers and composites, that can exhibit unique properties due to the presence of the bromine and fluorine atoms. This can lead to the creation of innovative materials with applications in various industries, including electronics, aerospace, and automotive.
Check Digit Verification of cas no
The CAS Registry Mumber 884495-01-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 884495-01:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*5)+(2*0)+(1*1)=216
216 % 10 = 6
So 884495-01-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrFNO/c6-3-1-5(9)8-2-4(3)7/h1-2H,(H,8,9)
