884495-04-9 Usage
Uses
Used in Organic Synthesis:
2-Fluoro-5-formyl-3-picoline is used as a building block in organic synthesis for the creation of various compounds. Its unique structure, including the fluorine and formyl groups, allows for a range of chemical reactions that can lead to the formation of diverse organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Fluoro-5-formyl-3-picoline serves as an intermediate in the production of pharmaceuticals. Its properties make it a valuable component in the development of new drugs, potentially contributing to the synthesis of molecules with specific therapeutic effects.
Used in Insecticide Development:
2-Fluoro-5-formyl-3-picoline has been investigated for its potential as an insecticide. Its chemical and physical properties suggest that it may have pesticidal activity, making it a candidate for further research and development in the field of agricultural chemistry.
The applications of 2-Fluoro-5-formyl-3-picoline highlight its importance in the fields of organic chemistry and drug discovery, as well as its potential in agricultural chemistry for pest control. Its unique structural features contribute to its versatility and utility in these areas.
Check Digit Verification of cas no
The CAS Registry Mumber 884495-04-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 884495-04:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*5)+(2*0)+(1*4)=219
219 % 10 = 9
So 884495-04-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FNO/c1-5-2-6(4-10)3-9-7(5)8/h2-4H,1H3
