884495-12-9 Usage
Uses
Used in Pharmaceutical Research:
5-Fluoro-4-formyl-2-methoxypyridine is used as a key intermediate in the synthesis of new drugs. Its unique structure and reactivity allow for the development of pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Development:
5-Fluoro-4-formyl-2-methoxypyridine is utilized as a building block in the creation of new agrochemicals. Its properties and potential biological activities contribute to the development of innovative products for agricultural applications.
Used in Organic Synthesis:
5-Fluoro-4-formyl-2-methoxypyridine serves as a versatile chemical in various organic synthesis processes. Its distinct functional groups enable the formation of a wide range of chemical compounds for scientific and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 884495-12-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 5 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 884495-12:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*5)+(2*1)+(1*2)=219
219 % 10 = 9
So 884495-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FNO2/c1-11-7-2-5(4-10)6(8)3-9-7/h2-4H,1H3
884495-12-9Relevant academic research and scientific papers
Novel Compounds
-
Page/Page column 74, (2008/06/13)
There is provided a compound of formula (I): processes for the manufacture thereof, pharmaceutical compositions thereof and uses in therapy.
