884497-47-6 Usage
General Description
2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid is a chemical compound with the molecular formula C7H9N3O2. It is a cyclopentane derivative that contains a pyrazole ring and a carboxylic acid functional group. 2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid has been studied for its potential use in pharmaceuticals and agrochemicals due to its unique structure and potential biological activity. It is also being researched for its potential as a building block for the synthesis of new molecules and materials. Further studies are needed to fully understand the properties and potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 884497-47-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 884497-47:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*7)+(2*4)+(1*7)=236
236 % 10 = 6
So 884497-47-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c10-7(11)6-4-2-1-3-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11)
