884497-47-6 Usage
Uses
Used in Pharmaceutical Industry:
2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid is used as a potential active pharmaceutical ingredient for the development of new drugs. Its unique structure and biological activity make it a candidate for various therapeutic applications, including the treatment of diseases and disorders.
Used in Agrochemical Industry:
In the agrochemical sector, 2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid is utilized as a potential component in the formulation of pesticides, herbicides, and other crop protection agents. Its unique properties may contribute to the development of more effective and environmentally friendly agrochemical products.
Used in Chemical Synthesis:
2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid serves as a building block for the synthesis of new molecules and materials. Its versatile structure allows for the creation of a wide range of compounds with potential applications in various industries, including pharmaceuticals, materials science, and chemical research.
Further studies are required to fully understand the properties and potential applications of 2,4,5,6-Tetrahydrocyclopenta[c]pyrazole-3-carboxylic acid, as its unique structure and biological activity hold promise for various industries and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 884497-47-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,4,9 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 884497-47:
(8*8)+(7*8)+(6*4)+(5*4)+(4*9)+(3*7)+(2*4)+(1*7)=236
236 % 10 = 6
So 884497-47-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O2/c10-7(11)6-4-2-1-3-5(4)8-9-6/h1-3H2,(H,8,9)(H,10,11)
