884500-89-4 Usage
General Description
Phenol, 4-(3-isoquinolinyl)-, hydrochloride (1:1) is a chemical compound that is commonly used as a research tool in the study of neurobiology and pharmacology. It is a derivative of phenol and isoquinoline, and its hydrochloride salt form is often used for its stability and solubility in aqueous solutions. Phenol, 4-(3-isoquinolinyl)-, hydrochloride (1:1) has been studied for its potential therapeutic applications in the treatment of various neurological disorders, including depression and anxiety. Its mechanism of action involves modulating certain neurotransmitter systems in the brain, particularly serotonin and dopamine. Additionally, it has been investigated for its potential role in the regulation of pain perception, making it a target for the development of novel analgesic medications.
Check Digit Verification of cas no
The CAS Registry Mumber 884500-89-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,5,0 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 884500-89:
(8*8)+(7*8)+(6*4)+(5*5)+(4*0)+(3*0)+(2*8)+(1*9)=194
194 % 10 = 4
So 884500-89-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H11NO.ClH/c17-14-7-5-11(6-8-14)15-9-12-3-1-2-4-13(12)10-16-15;/h1-10,17H;1H
