884507-29-3 Usage
Description
2-Thiomorpholinoisonicotinic acid, a chemical compound with the formula C10H13NO5S, is a modified derivative of the amino acid isonicotinic acid, featuring a thiomorpholino group attached to the carbon atom at position 2. 2-THIOMORPHOLINOISONICOTINIC ACID exhibits intriguing pharmacological properties and holds potential in medicinal chemistry and drug development. Its unique structural features position it as a promising candidate for further research and development, particularly in the synthesis of novel pharmaceutical compounds aimed at treating a range of diseases and conditions.
Uses
Used in Medicinal Chemistry:
2-Thiomorpholinoisonic acid is utilized as a building block in the synthesis of novel pharmaceutical compounds, leveraging its unique structural features to contribute to the development of new drugs for various diseases and conditions.
Used in Drug Development:
In the pharmaceutical industry, 2-Thiomorpholinoisonic acid is employed for its potential to enhance drug efficacy and target specific conditions. Its incorporation into drug formulations is driven by the need to innovate and improve upon existing treatments, offering patients more effective options for managing their health.
Check Digit Verification of cas no
The CAS Registry Mumber 884507-29-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,5,0 and 7 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 884507-29:
(8*8)+(7*8)+(6*4)+(5*5)+(4*0)+(3*7)+(2*2)+(1*9)=203
203 % 10 = 3
So 884507-29-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2O2S/c13-10(14)8-1-2-11-9(7-8)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14)