884507-52-2 Usage
Description
4-[(4-METHYLPERHYDRO-1,4-DIAZEPIN-1-YL)METHYL]BENZYLAMINE is a chemical compound with the molecular formula C16H26N2. It is a benzylamine derivative that contains a diazepinyl ring and a methyl group bonded to the nitrogen atom. 4-[(4-METHYLPERHYDRO-1,4-DIAZEPIN-1-YL)METHYL]BENZYLAMINE has potential pharmaceutical applications, particularly in the development of central nervous system drugs. Its chemical structure and properties make it suitable for further research and development for potential therapeutic uses.
Uses
Used in Pharmaceutical Industry:
4-[(4-METHYLPERHYDRO-1,4-DIAZEPIN-1-YL)METHYL]BENZYLAMINE is used as a chemical intermediate for the development of central nervous system drugs. Its unique chemical structure and properties make it a promising candidate for the creation of new therapeutic agents that can target specific neurological conditions and disorders.
Used in Research and Development:
4-[(4-METHYLPERHYDRO-1,4-DIAZEPIN-1-YL)METHYL]BENZYLAMINE is used as a research compound for studying its potential therapeutic effects and mechanisms of action. This can help scientists and researchers to better understand its potential applications and optimize its use in the development of new drugs and treatments for various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 884507-52-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,4,5,0 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 884507-52:
(8*8)+(7*8)+(6*4)+(5*5)+(4*0)+(3*7)+(2*5)+(1*2)=202
202 % 10 = 2
So 884507-52-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H23N3/c1-16-7-2-8-17(10-9-16)12-14-5-3-13(11-15)4-6-14/h3-6H,2,7-12,15H2,1H3