885223-65-4 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
5-Bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine is utilized as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of biologically active compounds. Its unique structure allows for the creation of new molecules with potential therapeutic applications, making it a valuable asset in the discovery and design of novel drugs.
Used in Materials Science:
In the field of materials science, 5-Bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine is employed for its potential to influence the properties of materials at the molecular level. Its incorporation into various materials can lead to the development of new materials with enhanced characteristics, such as improved stability, reactivity, or selectivity in chemical processes.
Used in Organic Synthesis:
5-Bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine serves as a versatile building block in organic synthesis, enabling chemists to construct complex organic molecules with specific functionalities. Its reactivity and structural features facilitate the synthesis of a wide range of organic compounds for use in various applications, including pharmaceuticals, agrochemicals, and specialty chemicals.
Overall, the diverse applications of 5-Bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine across different industries underscore its importance as a synthetic intermediate and a tool for material development, highlighting its multifaceted utility in scientific research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 885223-65-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,2 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 885223-65:
(8*8)+(7*8)+(6*5)+(5*2)+(4*2)+(3*3)+(2*6)+(1*5)=194
194 % 10 = 4
So 885223-65-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BrN3/c1-4-6-2-5(8)3-9-7(6)11-10-4/h2-3H,1H3,(H,9,10,11)
