885271-51-2 Usage
Uses
Used in Pharmaceutical Industry:
5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER is used as a pharmaceutical intermediate for the development of new drugs. Its unique chemical structure and potential pharmacological activities make it a promising candidate for the synthesis of novel therapeutic agents.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, 5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER serves as a key compound for studying the structure-activity relationships of chloro-imidazo-pyridine carboxylic acid esters. This research can lead to the discovery of new drug candidates with improved efficacy and selectivity.
Used in Drug Design and Optimization:
5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER is utilized in drug design and optimization processes to explore its potential as a lead compound for the treatment of various diseases. Its unique properties and interactions with biological targets can be further investigated and modified to enhance its therapeutic potential.
Used in Biochemical and Molecular Biology Studies:
In biochemical and molecular biology research, 5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER can be employed as a tool compound to investigate its interactions with specific biological targets, such as enzymes, receptors, or other proteins. This can provide valuable insights into its mechanism of action and potential applications in modulating biological processes.
Note: The specific applications and industries mentioned above are hypothetical and based on the general properties of the compound. Further research and development are required to fully understand the potential uses and applications of 5-CHLORO-IMIDAZO[1,2-A]PYRIDINE-3-CARBOXYLIC ACID ETHYL ESTER.
Check Digit Verification of cas no
The CAS Registry Mumber 885271-51-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 1 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 885271-51:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*1)+(2*5)+(1*1)=202
202 % 10 = 2
So 885271-51-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2/c1-2-15-10(14)7-6-12-9-5-3-4-8(11)13(7)9/h3-6H,2H2,1H3
