885271-54-5 Usage
Uses
Used in Chemical Research:
5-Chloro-Imidazo[1,5-a]pyridine-1-carboxylic Acid Ethyl Ester is used as a research compound for exploring its chemical properties and potential reactions. Its unique structure allows chemists to investigate its reactivity and interactions with other molecules, which can lead to the development of new chemical processes and products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 5-Chloro-Imidazo[1,5-a]pyridine-1-carboxylic Acid Ethyl Ester is used as a starting material or intermediate in the synthesis of various drug candidates. Its diverse biological activities make it a valuable compound for the development of new medications, particularly in the areas of oncology, cardiovascular, and neurological disorders.
Used in Drug Synthesis:
5-Chloro-Imidazo[1,5-a]pyridine-1-carboxylic Acid Ethyl Ester is used as a key component in the synthesis of pharmaceutical drugs. Its presence in the molecular structure can contribute to the drug's efficacy, potency, and selectivity, making it an essential part of the drug development process.
Used in Material Science:
In the field of material science, 5-Chloro-Imidazo[1,5-a]pyridine-1-carboxylic Acid Ethyl Ester can be used as a building block for the development of new materials with specific properties. Its incorporation into polymers or other materials can lead to the creation of materials with enhanced characteristics, such as improved stability, conductivity, or optical properties.
Used in Analytical Chemistry:
5-Chloro-Imidazo[1,5-a]pyridine-1-carboxylic Acid Ethyl Ester can be employed as a reference compound or standard in analytical chemistry. Its unique structure and properties make it suitable for use in calibration, quality control, and the development of new analytical methods and techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 885271-54-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 1 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 885271-54:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*1)+(2*5)+(1*4)=205
205 % 10 = 5
So 885271-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2/c1-2-15-10(14)9-7-4-3-5-8(11)13(7)6-12-9/h3-6H,2H2,1H3
