885271-75-0 Usage
Uses
Used in Medicinal Chemistry:
7-Bromo-3-chloro-1H-indazole is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential to contribute to the development of new drugs. Its unique structure allows for the creation of molecules with specific biological activities, targeting a range of therapeutic areas.
Used in Drug Discovery:
In the pharmaceutical industry, 7-Bromo-3-chloro-1H-indazole is utilized as a starting material for drug discovery, providing a foundation for the design and synthesis of novel therapeutic agents. Its chemical properties facilitate the exploration of new chemical space and the optimization of drug candidates.
Used in Material Science:
7-Bromo-3-chloro-1H-indazole may also find applications in material science, where its structural features could be leveraged to develop new materials with specific properties for various applications, such as in sensors, catalysts, or advanced materials for electronics and energy storage.
Used in Chemical Research:
As a chemical compound with distinctive characteristics, 7-Bromo-3-chloro-1H-indazole is used in research settings to study chemical reactions, mechanisms, and the properties of heterocyclic compounds. This contributes to the broader understanding of chemical processes and the development of new synthetic methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 885271-75-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 1 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 885271-75:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*1)+(2*7)+(1*5)=210
210 % 10 = 0
So 885271-75-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrClN2/c8-5-3-1-2-4-6(5)10-11-7(4)9/h1-3H,(H,10,11)
