885278-07-9 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Ethoxynicotinaldehyde is used as a key reactant for the synthesis of 5-aryl-7H-pyrazolo[4,3-d]pyrimidine-7-one derivatives. These compounds have been found to possess significant biological activities, making them important targets for the development of new drugs with potential therapeutic applications.
In the pharmaceutical industry, 2-Ethoxynicotinaldehyde plays a crucial role as a building block in the creation of novel drug candidates. Its unique structure allows for the formation of diverse chemical entities that can be further optimized for improved potency, selectivity, and pharmacokinetic properties. This makes it a valuable asset in the ongoing pursuit of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 885278-07-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 885278-07:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*8)+(2*0)+(1*7)=219
219 % 10 = 9
So 885278-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-2-11-8-7(6-10)4-3-5-9-8/h3-6H,2H2,1H3
