885278-57-9 Usage
Description
2-(3-METHYL-4-NITRO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is a chemical compound with the formula C15H13N3O4S. It is a thiazole derivative that contains a carboxylic acid and an ethyl ester functional group. 2-(3-METHYL-4-NITRO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER has a yellow crystalline appearance and is commonly used as a building block or intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the nitro and methyl groups in its structure give it potential for pharmacological and biological activity, making it a valuable compound in medicinal and chemical research.
Uses
Used in Pharmaceutical Industry:
2-(3-METHYL-4-NITRO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is used as a building block or intermediate for the synthesis of various pharmaceuticals. Its unique structure and functional groups make it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
2-(3-METHYL-4-NITRO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is also used as a building block or intermediate in the synthesis of agrochemicals. Its potential biological activity and chemical properties make it a valuable compound for the development of new agrochemical products with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 885278-57-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,7 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 885278-57:
(8*8)+(7*8)+(6*5)+(5*2)+(4*7)+(3*8)+(2*5)+(1*7)=229
229 % 10 = 9
So 885278-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2O4S/c1-3-19-13(16)10-7-20-12(14-10)9-4-5-11(15(17)18)8(2)6-9/h4-7H,3H2,1-2H3