885280-79-5 Usage
Uses
Used in Pharmaceutical Industry:
5-BROMO-2,3-DIHDRO-BENZOFURAN-3-YLAMINE HYDROCHLORIDE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs. Its structural properties allow for the creation of compounds with specific therapeutic effects.
Used in Research Applications:
In the research field, 5-BROMO-2,3-DIHYDRO-BENZOFURAN-3-YLAMINE HYDROCHLORIDE is utilized as a chemical probe to study various biological and chemical processes. Its reactivity and structural characteristics make it a valuable tool for understanding complex interactions and mechanisms.
Used in Organic Synthesis:
5-BROMO-2,3-DIHYDRO-BENZOFURAN-3-YLAMINE HYDROCHLORIDE is employed as a building block in organic synthesis for creating a range of organic compounds. Its versatility in chemical reactions facilitates the production of diverse molecules with specific functions and properties.
Used in Drug Development:
5-BROMO-2,3-DIHYDRO-BENZOFURAN-3-YLAMINE HYDROCHLORIDE is used as a precursor in drug development for its potential therapeutic applications. Its presence in the synthesis of new drugs highlights its importance in medicinal chemistry and the search for novel treatments.
Used in Chemical Compound Stability:
5-BROMO-2,3-DIHYDRO-BENZOFURAN-3-YLAMINE HYDROCHLORIDE is used to enhance the stability of certain chemical compounds. Its hydrochloride salt form provides increased stability, broadening the scope of its applications in various chemical and pharmaceutical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 885280-79-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,8 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 885280-79:
(8*8)+(7*8)+(6*5)+(5*2)+(4*8)+(3*0)+(2*7)+(1*9)=215
215 % 10 = 5
So 885280-79-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BrNO/c9-5-1-2-8-6(3-5)7(10)4-11-8/h1-3,7H,4,10H2
885280-79-5Relevant academic research and scientific papers
ALPHA, BETA-UNSATURATED AMIDE COMPOUND
-
Paragraph 1246; 1265, (2020/12/10)
An object of the present invention is to provide an α,β-unsaturated amide compound or a pharmaceutically acceptable salt or the like thereof having anticancer activity and the like. The α,β-unsaturated amide compound represented by the following formula (I) or a pharmaceutically acceptable salt or the like thereof has anticancer activity and the like: [wherein, "A" represents optionally substituted heterocyclic diyl, R1 represents hydrogen atom or optionally substituted lower alkyl, R2 represents optionally substituted aryl, optionally substituted cycloalkyl, optionally substituted aliphatic heterocyclic group or optionally substituted aromatic heterocyclic group, X represents -O-, -S-, -SO2-, -NRX1- (wherein, RX1 represents hydrogen atom or lower alkyl), -CHRX2- (wherein, RX2 represents hydrogen atom or hydroxy), -CH=CH-, -CO- or -NH-CO-, and n1 and n2 are the same or different, and each represents 0 or 1].
