885281-16-3 Usage
Uses
Used in Pharmaceutical Research:
2-Phenyl-imidazo[1,2,a]-4-piperidine is used as a potential drug candidate for its demonstrated therapeutic properties, including anti-inflammatory and analgesic effects. Its unique structure and pharmacological activity make it a valuable compound for the development of new medications, particularly in the areas of pain management and inflammation control.
Used in Drug Development:
In the pharmaceutical industry, 2-Phenyl-imidazo[1,2,a]-4-piperidine is utilized as a starting point for the synthesis of new drugs. Its heterocyclic nature and the presence of a phenyl group provide a versatile scaffold for chemical modifications, which can lead to the discovery of more potent and selective therapeutic agents.
Used in Medicinal Chemistry:
2-Phenyl-imidazo[1,2,a]-4-piperidine serves as a key intermediate in the synthesis of various bioactive molecules. Its structural features allow for the attachment of different functional groups, enabling the design of compounds with improved pharmacokinetic and pharmacodynamic properties.
While the provided materials do not specify different applications in various industries, the primary focus of 2-Phenyl-imidazo[1,2,a]-4-piperidine is within the pharmaceutical and medicinal chemistry fields, where its potential as a drug candidate and intermediate in drug synthesis is being explored. Further research will be crucial to unlock its full potential and understand its broader applications.
Check Digit Verification of cas no
The CAS Registry Mumber 885281-16-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,2,8 and 1 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 885281-16:
(8*8)+(7*8)+(6*5)+(5*2)+(4*8)+(3*1)+(2*1)+(1*6)=203
203 % 10 = 3
So 885281-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c1-2-4-10(5-3-1)11-8-14-12-9-13-6-7-15(11)12/h1-5,8,13H,6-7,9H2
