885522-04-3 Usage
Uses
Used in Pharmaceutical Research:
3-Bromo-6-fluoro (1H)indazole is used as a key intermediate in the synthesis of pharmaceutical compounds for the development of new drugs and biologically active molecules. Its unique structure allows for the creation of a wide range of organic compounds with potential therapeutic applications.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-Bromo-6-fluoro (1H)indazole is utilized as a building block for the design and synthesis of novel drug candidates. Its presence in the molecular structure can influence the pharmacokinetic and pharmacodynamic properties of the resulting compounds, making it a valuable tool in drug discovery.
Used in Organic Chemistry:
3-Bromo-6-fluoro (1H)indazole is employed as a versatile reagent in organic chemistry for the synthesis of various organic compounds. Its ability to be modified and incorporated into different molecular frameworks makes it a useful component in the creation of complex organic molecules.
Used in Research Reagent Applications:
3-Bromo-6-fluoro (1H)indazole serves as a research reagent in the study of indazole derivatives and their biological activities. It aids scientists in understanding the structure-activity relationships of these compounds and their potential applications in medicine and other fields.
Used in Drug Development:
In the drug development industry, 3-Bromo-6-fluoro (1H)indazole is used as a precursor in the creation of new pharmaceutical entities. Its unique properties can contribute to the discovery of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 885522-04-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,5,2 and 2 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 885522-04:
(8*8)+(7*8)+(6*5)+(5*5)+(4*2)+(3*2)+(2*0)+(1*4)=193
193 % 10 = 3
So 885522-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H4BrFN2/c8-7-5-2-1-4(9)3-6(5)10-11-7/h1-3H,(H,10,11)
