88574-06-5 Usage
Description
Fmoc-6-aminohexanoic acid is an amino acid derivative characterized by an alkane chain with terminal Fmoc-protected amine and carboxylic acid groups. FMOC-6-AMINOHEXANOIC ACID is a white powder that can be deprotected under basic conditions to reveal the free amine, which can then be used for further conjugations. The terminal carboxylic acid is reactive with primary amine groups in the presence of activators such as EDC or HATU, allowing the formation of stable amide bonds.
Uses
Used in Chemical Synthesis and Peptide Chemistry:
Fmoc-6-aminohexanoic acid is utilized as a building block in the synthesis of various chemical compounds and peptides. Its unique structure and reactivity make it a valuable component in the creation of complex molecules and biologically active peptides.
Used as a PROTAC Linker in the Synthesis of PROTACs:
Fmoc-6-aminohexanoic acid serves as an effective linker in the development of proteolysis-targeting chimeras (PROTACs). These molecules are designed to facilitate the degradation of specific proteins, offering a promising approach to targeted protein degradation for therapeutic purposes.
Used in Conjugation Applications:
Due to its ability to form stable amide bonds with primary amine groups, Fmoc-6-aminohexanoic acid is employed in conjugation processes. This allows for the attachment of various functional groups or molecules to create new compounds with specific properties or applications.
Check Digit Verification of cas no
The CAS Registry Mumber 88574-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,5,7 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 88574-06:
(7*8)+(6*8)+(5*5)+(4*7)+(3*4)+(2*0)+(1*6)=175
175 % 10 = 5
So 88574-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C21H23NO4/c23-20(24)12-2-1-7-13-22-21(25)26-14-19-17-10-5-3-8-15(17)16-9-4-6-11-18(16)19/h3-6,8-11,19H,1-2,7,12-14H2,(H,22,25)(H,23,24)