885951-06-4 Usage
General Description
Methyl-(2-pyrrolidin-1-ylmethyl-1,2,3,4-tetrahydro-naphthalen-2-yl)-amine is a chemical compound with a complex molecular structure. It consists of a methyl group attached to the nitrogen atom of a pyrrolidine ring, which is in turn connected to a tetrahydro-naphthalene group. METHYL-(2-PYRROLIDIN-1-YLMETHYL-1,2,3,4-TETRAHYDRO-NAPHTHALEN-2-YL)-AMINE is an amine, which means it contains a nitrogen atom with a lone pair of electrons, making it basic in nature. It is commonly used in pharmaceutical research and may have potential applications in the development of new drugs due to its specific molecular structure and potential biological activities. Additionally, its diverse chemical and structural properties may make it useful in a variety of other industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 885951-06-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,9,5 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 885951-06:
(8*8)+(7*8)+(6*5)+(5*9)+(4*5)+(3*1)+(2*0)+(1*6)=224
224 % 10 = 4
So 885951-06-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H24N2/c1-17-16(13-18-10-4-5-11-18)9-8-14-6-2-3-7-15(14)12-16/h2-3,6-7,17H,4-5,8-13H2,1H3