885952-25-0 Usage
General Description
2-Benzylamino-4-benzyloxy-5-bromopyrimidine is a chemical compound that consists of a pyrimidine ring substituted with a benzylamino group at the 2-position, a benzyloxy group at the 4-position, and a bromine atom at the 5-position. It is commonly used in the field of medicinal chemistry as a building block for the synthesis of various organic compounds, including potential pharmaceutical agents. 2-BENZYLAMINO-4-BENZYLOXY-5-BROMOPYRIMIDINE has demonstrated potential as an antiproliferative and anticancer agent, and its structure provides opportunities for further functionalization to enhance its biological activity. Additionally, it has shown promise as a potential scaffold for the development of new bioactive compounds with diverse biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 885952-25-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,9,5 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 885952-25:
(8*8)+(7*8)+(6*5)+(5*9)+(4*5)+(3*2)+(2*2)+(1*5)=230
230 % 10 = 0
So 885952-25-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H16BrN3O/c19-16-12-21-18(20-11-14-7-3-1-4-8-14)22-17(16)23-13-15-9-5-2-6-10-15/h1-10,12H,11,13H2,(H,20,21,22)