885959-24-0 Usage
Description
2-METHYL-OCTAHYDRO-PYRROLO[3,4-C]PYRIDINE, also known as Octahydro-2-methyl-1H-pyrrolo[3,4-c]pyridine, is an organic compound with a unique heterocyclic structure. It is characterized by its octahydro-pyrrolo[3,4-c]pyridine core, which features a methyl group at the 2-position. 2-METHYL-OCTAHYDRO-PYRROLO[3,4-C]PYRIDINE has potential applications in the pharmaceutical industry due to its ability to form heterocycles with inhibitory properties.
Uses
Used in Pharmaceutical Industry:
2-METHYL-OCTAHYDRO-PYRROLO[3,4-C]PYRIDINE is used as a precursor in the synthesis of heterocycles for its role as an mTOR inhibitor. These heterocycles are valuable in the development of drugs targeting the mTOR pathway, which plays a crucial role in various cellular processes, including cell growth, proliferation, and survival. Inhibition of the mTOR pathway can have therapeutic benefits in treating certain types of cancer and other diseases characterized by uncontrolled cell growth.
Check Digit Verification of cas no
The CAS Registry Mumber 885959-24-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,9,5 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 885959-24:
(8*8)+(7*8)+(6*5)+(5*9)+(4*5)+(3*9)+(2*2)+(1*4)=250
250 % 10 = 0
So 885959-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2/c1-10-5-7-2-3-9-4-8(7)6-10/h7-9H,2-6H2,1H3
