885965-89-9 Usage
Uses
Used in Pharmaceutical Research:
2-(3,4-Difluoro-phenyl)-acetamidin is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with improved efficacy and selectivity.
Used in Medicinal Chemistry:
2-(3,4-Difluoro-phenyl)-acetamidin is utilized as a building block in medicinal chemistry for the design and synthesis of novel therapeutic agents. Its presence in a molecule can modulate the pharmacokinetic and pharmacodynamic properties, leading to enhanced drug performance.
Used in Antibacterial Applications:
2-(3,4-Difluoro-phenyl)-acetamidin has been studied for its antibacterial properties, making it a potential candidate for the development of new antibiotics to combat resistant bacterial strains.
Used in Antifungal Applications:
2-(3,4-DIFLUORO-PHENYL)-ACETAMIDINE is also being investigated for its antifungal activities, which could lead to the creation of new antifungal agents to treat various fungal infections.
Used in Chemical Synthesis Industry:
2-(3,4-Difluoro-phenyl)-acetamidin is employed as a versatile reagent in the chemical synthesis industry, contributing to the production of a wide range of chemical products, including specialty chemicals and intermediates for further reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 885965-89-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,5,9,6 and 5 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 885965-89:
(8*8)+(7*8)+(6*5)+(5*9)+(4*6)+(3*5)+(2*8)+(1*9)=259
259 % 10 = 9
So 885965-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H8F2N2/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2,(H3,11,12)
