88598-08-7 Usage
Uses
Used in Pharmaceutical Industry:
1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID is used as a building block for the synthesis of various pharmaceuticals due to its unique molecular structure and biological activities. It contributes to the development of new drugs with improved therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID is used as a building block for the synthesis of agrochemicals, such as pesticides and herbicides. Its incorporation into these products enhances their effectiveness in controlling pests and weeds, thereby improving crop yields and quality.
Used as a Corrosion Inhibitor:
1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID is used as a corrosion inhibitor in various industrial applications. Its ability to form protective films on metal surfaces helps prevent corrosion, extending the lifespan of equipment and reducing maintenance costs.
Used as an Intermediate in Heterocyclic Synthesis:
1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID serves as an intermediate for the synthesis of other heterocyclic compounds. Its unique structure allows for the formation of diverse heterocyclic compounds with various applications in chemical research and industry.
Used in Research and Development:
Due to its wide range of biological activities, 1,2,5-OXADIAZOLE-3-CARBOXYLIC ACID is extensively used in research and development for exploring its potential applications in various fields, such as drug discovery, material science, and chemical synthesis. Its versatile properties make it an invaluable tool for scientists and researchers.
Check Digit Verification of cas no
The CAS Registry Mumber 88598-08-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,8,5,9 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 88598-08:
(7*8)+(6*8)+(5*5)+(4*9)+(3*8)+(2*0)+(1*8)=197
197 % 10 = 7
So 88598-08-7 is a valid CAS Registry Number.
InChI:InChI=1/C3H2N2O3/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7)
88598-08-7Relevant academic research and scientific papers
MONOSUBSTITUTED FURAZANES. I. NMR INVESTIGATION
Strelenko, Yu. A.,Sheremetev, A. B.,Khmel'nitskii, L. I.
, p. 927 - 930 (2007/10/02)
The 1H, 13C, 15N and 17O NMR spectral parameters were obtained for monosubstituted furazanes and the 13C NMR chemical shifts of these compounds were correlated with the chemical shifts of monosubstituted benzenes.
