886361-83-7 Usage
Uses
Used in Pharmaceutical Industry:
3-(Dimethylamino)-2-(2-bromobenzoyl)acrylonitrile is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new therapeutic agents. Its unique structure allows for the creation of a variety of bioactive compounds that can address specific medical needs.
Used in Agrochemical Industry:
In the agrochemical sector, 3-(Dimethylamino)-2-(2-bromobenzoyl)acrylonitrile is utilized as a precursor in the production of agrochemicals, aiding in the development of effective compounds for crop protection and enhancement of agricultural yields.
Used in Organic Synthesis:
3-(Dimethylamino)-2-(2-bromobenzoyl)acrylonitrile is employed as a versatile reagent in organic synthesis, where its unique functional groups facilitate a range of chemical reactions, leading to the formation of diverse organic compounds with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 886361-83-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 1 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 886361-83:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*1)+(2*8)+(1*3)=217
217 % 10 = 7
So 886361-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H11BrN2O/c1-15(2)8-9(7-14)12(16)10-5-3-4-6-11(10)13/h3-6,8H,1-2H3/b9-8-
