886362-38-5 Usage
General Description
3-N-FMOC-AMINO-3-(3'-CBZ)PIPERIDINE-PROPIONIC ACID is a chemical compound commonly used in the field of organic synthesis. It is a derivative of piperidine, a heterocyclic amine, and contains both Fmoc and Cbz protective groups. The Fmoc group is often used to protect the N-terminal amino group of peptides during solid-phase synthesis, while the Cbz group is commonly used to protect the N-terminal amino group of amino acids. The propionic acid group in the compound suggests that it may have potential applications in drug delivery or bioconjugation chemistry. Overall, 3-N-FMOC-AMINO-3-(3'-CBZ)PIPERIDINE-PROPIONIC ACID is a versatile compound with potential uses in various chemical and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-38-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 886362-38:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*3)+(1*8)=215
215 % 10 = 5
So 886362-38-5 is a valid CAS Registry Number.
InChI:InChI=1/C31H32N2O6/c34-29(35)17-28(22-11-8-16-33(18-22)31(37)39-19-21-9-2-1-3-10-21)32-30(36)38-20-27-25-14-6-4-12-23(25)24-13-5-7-15-26(24)27/h1-7,9-10,12-15,22,27-28H,8,11,16-20H2,(H,32,36)(H,34,35)