886362-40-9 Usage
Uses
Used in Pharmaceutical Industry:
3-(2-CARBOXY-ACETYL)-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER is used as a building block for the creation of peptide-based drugs and pharmaceuticals. Its ability to effectively couple amino acids and create peptide bonds makes it an essential component in the development of various pharmaceuticals and biochemical compounds.
Used in Organic Synthesis:
In the field of organic synthesis, 3-(2-CARBOXY-ACETYL)-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER is used as a key intermediate for the synthesis of complex organic molecules. Its unique reactivity allows for the formation of various functional groups and the construction of diverse molecular architectures.
Used in Peptide Chemistry:
3-(2-CARBOXY-ACETYL)-PIPERIDINE-1-CARBOXYLIC ACID BENZYL ESTER is employed as a coupling reagent in peptide chemistry, facilitating the formation of peptide bonds between amino acids. This enhances the efficiency and selectivity of peptide synthesis, leading to the production of biologically active peptides and peptidomimetics.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-40-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 886362-40:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*4)+(1*0)=209
209 % 10 = 9
So 886362-40-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H19NO5/c18-14(9-15(19)20)13-7-4-8-17(10-13)16(21)22-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,19,20)
