886362-64-7 Usage
Uses
Used in Pharmaceutical Industry:
1-N-CBZ-4-HYDROXY-BETA-PROLINE is used as a key intermediate in the synthesis of peptide-based drugs for its ability to facilitate the creation of complex peptide structures that can target specific biological pathways.
Used in Academic Research:
1-N-CBZ-4-HYDROXY-BETA-PROLINE is utilized as a building block in the preparation of various peptidomimetics for the development of novel drugs and therapeutic agents, allowing researchers to explore new avenues in medicinal chemistry and drug discovery.
Used in Drug Synthesis:
1-N-CBZ-4-HYDROXY-BETA-PROLINE is used as a crucial component in the synthesis of biologically active compounds, enabling the production of new pharmaceuticals with potential applications in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-64-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 886362-64:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*4)=217
217 % 10 = 7
So 886362-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO5/c15-11-7-14(6-10(11)12(16)17)13(18)19-8-9-4-2-1-3-5-9/h1-5,10-11,15H,6-8H2,(H,16,17)
