886362-65-8 Usage
General Description
1-N-CBZ-PYRROLIDINE-3-ACETIC ACID is a chemical compound with the molecular formula C16H21NO4. It is a derivative of pyrrolidine and has a carbobenzyloxy (Cbz) protecting group attached to the nitrogen atom. 1-N-CBZ-PYRROLIDINE-3-ACETIC ACID is commonly used as a reagent in organic synthesis, particularly in the production of pharmaceuticals and other fine chemicals. It is known for its ability to selectively protect the nitrogen atom in the pyrrolidine ring, allowing for further chemical reactions to occur. Additionally, 1-N-CBZ-PYRROLIDINE-3-ACETIC ACID can also be used as a building block for the synthesis of various bioactive compounds. With its versatile reactivity and importance in organic chemistry, this compound plays a crucial role in the development of new drugs and other biologically active molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-65-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 886362-65:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*5)=218
218 % 10 = 8
So 886362-65-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H17NO4/c16-13(17)8-12-6-7-15(9-12)14(18)19-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,17)
