886362-67-0 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Difluoro-2-methylindole-3-carboxylic acid ethyl ester is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of drugs with novel therapeutic properties. Its unique structure allows for the creation of compounds with potential applications in treating a range of diseases and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 4,5-Difluoro-2-methylindole-3-carboxylic acid ethyl ester serves as an essential component in the formulation of agrochemicals, such as pesticides and herbicides. Its incorporation aids in enhancing the effectiveness of these products, contributing to improved crop protection and yield.
Used in Medicinal Chemistry Research:
4,5-Difluoro-2-methylindole-3-carboxylic acid ethyl ester is utilized as a research tool in medicinal chemistry, where it is employed to explore new chemical entities and investigate their potential as therapeutic agents. Its unique structural features make it a promising candidate for the development of innovative drugs with improved pharmacological profiles.
Used in Drug Discovery:
4,5-DIFLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER plays a significant role in drug discovery processes, where it is used to identify and optimize lead compounds with potential therapeutic applications. Its versatility in chemical reactions and its ability to be modified to create a variety of derivatives make it an invaluable asset in the search for new medicines.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 886362-67:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*7)=220
220 % 10 = 0
So 886362-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H11F2NO2/c1-3-17-12(16)9-6(2)15-8-5-4-7(13)11(14)10(8)9/h4-5,15H,3H2,1-2H3
