886362-69-2 Usage
Uses
Used in Organic Synthesis:
6-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is used as a building block in organic synthesis for the creation of biologically active molecules. Its unique structure and functional groups allow for the development of new compounds with potential applications in various fields.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 6-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is used as a key intermediate for the synthesis of pharmaceutical compounds. Its ethyl ester form and the presence of a fluorine atom contribute to the compound's reactivity and potential for the development of new drugs.
Used in Drug Discovery Research and Development:
6-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is utilized in drug discovery research and development as a starting material for the synthesis of potential drug candidates. Its versatility and reactivity make it a valuable component in the design and synthesis of novel therapeutic agents.
Used in Pharmaceutical Industry:
6-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is used as a building block in the pharmaceutical industry for the synthesis of various pharmaceutical products. Its unique properties and functional groups enable the development of innovative drugs with improved efficacy and safety profiles.
Used in Agrochemical Industry:
In the agrochemical industry, 6-FLUORO-2-METHYLINDOLE-3-CARBOXYLIC ACID ETHYL ESTER is employed as a key component in the synthesis of agrochemical products. Its versatility and reactivity contribute to the development of new pesticides, herbicides, and other agrochemicals with enhanced performance and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-69-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886362-69:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*6)+(1*9)=222
222 % 10 = 2
So 886362-69-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H12FNO2/c1-3-16-12(15)11-7(2)14-10-6-8(13)4-5-9(10)11/h4-6,14H,3H2,1-2H3
