886362-79-4 Usage
Uses
Used in Pharmaceutical Industry:
3-Methoxy-2,4,5-trifluorobenzylamine is used as a synthetic intermediate for the development of pharmaceuticals. Its unique structure allows it to modify and enhance the biological activity of certain drugs, contributing to the advancement of new therapeutic agents.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Methoxy-2,4,5-trifluorobenzylamine serves as a key component in the synthesis of various agrochemicals, potentially improving the effectiveness of pesticides and other agricultural chemicals.
Used in Research and Development:
3-Methoxy-2,4,5-trifluorobenzylamine is utilized as a building block for the creation of novel molecules with diverse biological activities. Its presence in the development of new chemical entities makes it a valuable asset for researchers and chemists exploring innovative applications across various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-79-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886362-79:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*7)+(1*9)=224
224 % 10 = 4
So 886362-79-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H8F3NO/c1-13-8-6(10)4(3-12)2-5(9)7(8)11/h2H,3,12H2,1H3
