886362-85-2 Usage
Uses
Used in Pharmaceutical Research and Organic Synthesis:
3-ISATOIC ANHYDRIDE CARBOXYLIC ACID METHYL ESTER is used as a reagent for the synthesis of heterocyclic compounds and pharmaceutical intermediates due to its unique chemical properties and reactivity. Its ability to form various chemical bonds and participate in complex reactions makes it a crucial component in the development of new pharmaceuticals and organic compounds.
Used in the Production of Pharmaceuticals:
3-ISATOIC ANHYDRIDE CARBOXYLIC ACID METHYL ESTER is used as a key ingredient in the production of various pharmaceuticals. Its unique chemical structure allows it to be incorporated into the molecular frameworks of different drugs, potentially enhancing their therapeutic effects and properties.
Used in Research Chemicals:
3-ISATOIC ANHYDRIDE CARBOXYLIC ACID METHYL ESTER is used as a research chemical for studying its properties and potential applications in various fields. Its unique reactivity and chemical structure make it an interesting subject for scientific research, potentially leading to the discovery of new compounds and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-85-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 886362-85:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*8)+(1*5)=222
222 % 10 = 2
So 886362-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO5/c1-15-8(12)5-3-2-4-6-7(5)11-10(14)16-9(6)13/h2-4H,1H3,(H,11,14)
886362-85-2Relevant academic research and scientific papers
NEUROTRYPSIN INHIBITORS
-
Page/Page column 91, (2012/05/20)
The invention relates to acylamino-phthalic acid amides and related compounds of formula (I) wherein A is -CONR3R4,-NR5COR6, -NHR7, -OR8, -mR9, -CH2NRI0R11, -(CH2)2-R12, -CH=CH-R12, -C=C-R12, optionally substituted phenyl, optionally substituted thiophenyl, or optionally substituted 1,2,3-triazol-4-yl, W is hydrogen, hydroxy or carboxymethoxy, Y is carboxy, methoxycarbonyl or 2H-tetrazol-5-yl, and the various substituents R have the meanings indicated in the description. These compounds are useful for the treatment and/or prophylaxis of skeletal muscle atrophy, schizophrenia and Alzheimer?s disease, and as cognitive enhancers.
