886362-99-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
METHYL-[1-(1-METHYL-PIPERIDIN-4-YL)-2-PYRROLIDIN-1-YL-ETHYL]-AMINE is used as a chemical intermediate for the synthesis of new pharmaceutical compounds, given its potential to be incorporated into drug molecules that could address a range of medical conditions. Its unique structure and functional groups provide a foundation for the development of innovative therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, METHYL-[1-(1-METHYL-PIPERIDIN-4-YL)-2-PYRROLIDIN-1-YL-ETHYL]-AMINE is utilized as a building block for designing and optimizing drug candidates. Its presence in a molecule can influence pharmacokinetic and pharmacodynamic properties, such as solubility, stability, and receptor binding affinity, which are critical for drug efficacy and safety.
Used in the Treatment of Various Medical Conditions:
While the specific applications are still under investigation, METHYL-[1-(1-METHYL-PIPERIDIN-4-YL)-2-PYRROLIDIN-1-YL-ETHYL]-AMINE holds promise for use in the treatment of various medical conditions. Its incorporation into drug molecules could potentially lead to new therapies for a range of diseases, depending on its pharmacological properties once they are fully understood and exploited in drug design.
Check Digit Verification of cas no
The CAS Registry Mumber 886362-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 2 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 886362-99:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*2)+(2*9)+(1*9)=228
228 % 10 = 8
So 886362-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H27N3/c1-14-13(11-16-7-3-4-8-16)12-5-9-15(2)10-6-12/h12-14H,3-11H2,1-2H3
