886363-06-0 Usage
Uses
As the specific uses and properties of METHYL-(4-PYRROLIDIN-1-YLMETHYL-TETRAHYDRO-PYRAN-4-YL)-CARBAMIC ACID BENZYL ESTER are not explicitly detailed in the provided materials, the following applications are speculative and based on the compound's structural features:
Used in Pharmaceutical Industry:
METHYL-(4-PYRROLIDIN-1-YLMETHYL-TETRAHYDRO-PYRAN-4-YL)-CARBAMIC ACID BENZYL ESTER could be used as a pharmaceutical intermediate for the synthesis of various drug molecules. Its carbamic acid and benzyl ester groups may allow it to participate in chemical reactions that form new compounds with potential therapeutic effects.
Used in Chemical Research:
In the field of chemical research, METHYL-(4-PYRROLIDIN-1-YLMETHYL-TETRAHYDRO-PYRAN-4-YL)-CARBAMIC ACID BENZYL ESTER might serve as a model compound for studying the reactivity and properties of complex organic molecules. Its unique structure could provide insights into new reaction pathways and mechanisms.
Used in Material Science:
METHYL-(4-PYRROLIDIN-1-YLMETHYL-TETRAHYDRO-PYRAN-4-YL)-CARBAMIC ACID BENZYL ESTER's structural components may also lend themselves to applications in material science, where it could be explored for its potential to form new polymers or contribute to the development of advanced materials with specific properties.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-06-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 886363-06:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*0)+(1*6)=210
210 % 10 = 0
So 886363-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C19H28N2O3/c1-20(18(22)24-15-17-7-3-2-4-8-17)19(9-13-23-14-10-19)16-21-11-5-6-12-21/h2-4,7-8H,5-6,9-16H2,1H3