886363-63-9 Usage
Uses
Used in Pharmaceutical Synthesis:
(4-FLUORO-PHENYL)-(4-OXO-PIPERIDIN-1-YL)-ACETIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals due to its structural features that can be further modified to create new drug candidates.
Used in Organic Chemistry Research:
In the field of organic chemistry, (4-FLUORO-PHENYL)-(4-OXO-PIPERIDIN-1-YL)-ACETIC ACID is used as a building block for the development of novel organic compounds, potentially leading to new materials or chemical processes.
Used in Drug Discovery:
(4-FLUORO-PHENYL)-(4-OXO-PIPERIDIN-1-YL)-ACETIC ACID is utilized in drug discovery efforts, where its diverse pharmacological properties, including potential analgesic, anti-inflammatory, and anti-tumor activities, are explored for the development of new therapeutic agents.
Used in Chemical Research:
(4-FLUORO-PHENYL)-(4-OXO-PIPERIDIN-1-YL)-ACETIC ACID serves as a subject of study in chemical research, where its properties and reactivity are investigated to understand its behavior and potential applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-63-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 886363-63:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*6)+(1*3)=219
219 % 10 = 9
So 886363-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H14FNO3/c14-10-3-1-9(2-4-10)12(13(17)18)15-7-5-11(16)6-8-15/h1-4,12H,5-8H2,(H,17,18)
