886363-83-3 Usage
General Description
1-[2-AMINO-1-(2-CHLORO-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID, also known as (2S)-2-[(2S)-2-amino-2-(2-chlorophenyl)ethyl]-3-carboxyproline, is a chemical compound that belongs to the class of pyrrolidine carboxylic acids. It is a derivative of proline and contains an amino group, a carboxylic acid group, and a chlorophenyl group. 1-[2-AMINO-1-(2-CHLORO-PHENYL)-ETHYL]-PYRROLIDINE-3-CARBOXYLIC ACID is commonly used in the pharmaceutical industry as a building block for the synthesis of various drugs and drug candidates. It also has potential applications in the field of organic chemistry and medicinal chemistry, where it can be used as a precursor for the preparation of biologically active compounds. Additionally, its unique structural features make it an interesting target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 886363-83-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 886363-83:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*3)+(2*8)+(1*3)=223
223 % 10 = 3
So 886363-83-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClN2O2/c14-11-4-2-1-3-10(11)12(7-15)16-6-5-9(8-16)13(17)18/h1-4,9,12H,5-8,15H2,(H,17,18)