886364-05-2 Usage
Uses
Used in Pharmaceutical Industry:
1-(2-AMINO-1-P-TOLYL-ETHYL)-PYRROLIDINE-3-CARBOXYLIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its ability to form complex molecular structures and functional groups, contributing to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
1-(2-AMINO-1-P-TOLYL-ETHYL)-PYRROLIDINE-3-CARBOXYLIC ACID is used as a building block in the creation of agrochemicals, such as pesticides and herbicides, due to its versatile molecular structure and functional groups that can be tailored for specific agricultural applications.
Used in Research and Development:
1-(2-AMINO-1-P-TOLYL-ETHYL)-PYRROLIDINE-3-CARBOXYLIC ACID is used as a key component in the research and development of new chemical compounds, allowing scientists to explore its potential applications in various fields, including materials science, nanotechnology, and environmental chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 886364-05-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 4 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 886364-05:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*4)+(2*0)+(1*5)=212
212 % 10 = 2
So 886364-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O2/c1-10-2-4-11(5-3-10)13(8-15)16-7-6-12(9-16)14(17)18/h2-5,12-13H,6-9,15H2,1H3,(H,17,18)
