886364-14-3 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
3-(3-AMINOPHENYL)-DL-BETA-ALANINOL is used as a pharmaceutical intermediate for its potential pharmacological properties, playing a crucial role in the synthesis of various medicinal compounds.
Used in Chemical Synthesis:
3-(3-AMINOPHENYL)-DL-BETA-ALANINOL is used as a reagent in chemical synthesis processes, contributing to the production of a range of organic compounds.
Used in Organic Compound Production:
3-(3-AMINOPHENYL)-DL-BETA-ALANINOL is used as a building block in the creation of various organic compounds, leveraging its unique structural features to enhance the properties of the final products.
While the provided materials do not specify different applications across various industries, the general uses outlined above are based on the compound's properties and common applications in the fields of chemistry and pharmaceuticals. If there are specific industry applications not covered in the provided materials, those would need to be researched and added separately.
Check Digit Verification of cas no
The CAS Registry Mumber 886364-14-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 4 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 886364-14:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*4)+(2*1)+(1*4)=213
213 % 10 = 3
So 886364-14-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O/c10-8-3-1-2-7(6-8)9(11)4-5-12/h1-3,6,9,12H,4-5,10-11H2
