886364-15-4 Usage
Uses
Used in Pharmaceutical Research:
DLA is utilized as a key component in the development of innovative drugs, targeting a spectrum of diseases and conditions. Its unique structural features and chemical properties contribute to its potential as a therapeutic agent, driving ongoing research and development efforts in the pharmaceutical industry.
Used in Organic Synthesis:
In the realm of organic chemistry, DLA serves as a valuable building block for the synthesis of other chemical compounds. Its reactivity and structural attributes make it a useful precursor in the creation of a variety of organic molecules, broadening its applications beyond direct therapeutic use.
Used in Chemical Compound Production:
DLA's role as a fundamental component extends to the production of other chemical entities, where it contributes to the formation of complex molecules with diverse applications. Its versatility in chemical reactions and compatibility with various synthetic pathways underscores its importance in the field of chemical compound production.
Check Digit Verification of cas no
The CAS Registry Mumber 886364-15-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,8,6,3,6 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 886364-15:
(8*8)+(7*8)+(6*6)+(5*3)+(4*6)+(3*4)+(2*1)+(1*5)=214
214 % 10 = 4
So 886364-15-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O/c10-8-4-2-1-3-7(8)9(11)5-6-12/h1-4,9,12H,5-6,10-11H2
